C11H21NO7P+ — CID 87306682
[3-hydroxy-3-[1-(2-methylpropanoyloxy)ethoxycarbonylamino]propoxy]-methyl-oxophosphanium (PubChem CID 87306682) has the molecular formula C11H21NO7P+ and a molecular weight of 310.26 g/mol. Its IUPAC name is [3-hydroxy-3-[1-(2-methylpropanoyloxy)ethoxycarbonylamino]propoxy]-methyl-oxophosphanium.
| Compound Name | [3-hydroxy-3-[1-(2-methylpropanoyloxy)ethoxycarbonylamino]propoxy]-methyl-oxophosphanium |
|---|---|
| PubChem CID | 87306682 |
| Molecular Formula | C11H21NO7P+ |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | [3-hydroxy-3-[1-(2-methylpropanoyloxy)ethoxycarbonylamino]propoxy]-methyl-oxophosphanium |
| SMILES | CC(OC(=O)NC(O)CCO[P+](C)=O)OC(=O)C(C)C |
| InChI | InChI=1S/C11H20NO7P/c1-7(2)10(14)18-8(3)19-11(15)12-9(13)5-6-17-20(4)16/h7-9,13H,5-6H2,1-4H3/p+1 |
| InChIKey | SLBAEDRIKKKVOE-UHFFFAOYSA-O |
| XLogP | 1.36 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|