C16H22N2O3 — CID 87461192
N-hydroxy-N-(2-oxo-3,4-dihydropyridin-1-yl)adamantane-1-carboxamide (PubChem CID 87461192) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is N-hydroxy-N-(2-oxo-3,4-dihydropyridin-1-yl)adamantane-1-carboxamide.
| Compound Name | N-hydroxy-N-(2-oxo-3,4-dihydropyridin-1-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 87461192 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N-hydroxy-N-(2-oxo-3,4-dihydropyridin-1-yl)adamantane-1-carboxamide |
| SMILES | O=C1CCC=CN1N(O)C(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H22N2O3/c19-14-3-1-2-4-17(14)18(21)15(20)16-8-11-5-12(9-16)7-13(6-11)10-16/h2,4,11-13,21H,1,3,5-10H2 |
| InChIKey | OEVNRDZYPCAXIC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|