C27H32N6O4 — CID 87461512
2-(2-hydroxyethylamino)ethanol;N-hydroxy-2-[8-(3-methylphenyl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]pyrimidine-5-carboxamide (PubChem CID 87461512) has the molecular formula C27H32N6O4 and a molecular weight of 504.59 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)ethanol;N-hydroxy-2-[8-(3-methylphenyl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]pyrimidine-5-carboxamide.
| Compound Name | 2-(2-hydroxyethylamino)ethanol;N-hydroxy-2-[8-(3-methylphenyl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 87461512 |
| Molecular Formula | C27H32N6O4 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 2-(2-hydroxyethylamino)ethanol;N-hydroxy-2-[8-(3-methylphenyl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]pyrimidine-5-carboxamide |
| SMILES | Cc1cccc(-c2ccc3[nH]c4c(c3c2)CN(c2ncc(C(=O)NO)cn2)CC4)c1.OCCNCCO |
| InChI | InChI=1S/C23H21N5O2.C4H11NO2/c1-14-3-2-4-15(9-14)16-5-6-20-18(10-16)19-13-28(8-7-21(19)26-20)23-24-11-17(12-25-23)22(29)27-30;6-3-1-5-2-4-7/h2-6,9-12,26,30H,7-8,13H2,1H3,(H,27,29);5-7H,1-4H2 |
| InChIKey | GZJDGOIFWYJLRN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 146.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|