C16H32ClNO2 — CID 87473961
3-chloro-N,N-dimethyldecan-1-amine;2-methylprop-2-enoic acid (PubChem CID 87473961) has the molecular formula C16H32ClNO2 and a molecular weight of 305.89 g/mol. Its IUPAC name is 3-chloro-N,N-dimethyldecan-1-amine;2-methylprop-2-enoic acid.
| Compound Name | 3-chloro-N,N-dimethyldecan-1-amine;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 87473961 |
| Molecular Formula | C16H32ClNO2 |
| Molecular Weight | 305.89 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 3-chloro-N,N-dimethyldecan-1-amine;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CCCCCCCC(Cl)CCN(C)C |
| InChI | InChI=1S/C12H26ClN.C4H6O2/c1-4-5-6-7-8-9-12(13)10-11-14(2)3;1-3(2)4(5)6/h12H,4-11H2,1-3H3;1H2,2H3,(H,5,6) |
| InChIKey | RHRHOPNUZUAYAZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.89 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|