C17H24N2O2S — CID 87474347
4-[3-(4,4-dimethylpentoxy)-2-methoxyphenyl]-1,3-thiazol-2-amine (PubChem CID 87474347) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is 4-[3-(4,4-dimethylpentoxy)-2-methoxyphenyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[3-(4,4-dimethylpentoxy)-2-methoxyphenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 87474347 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 4-[3-(4,4-dimethylpentoxy)-2-methoxyphenyl]-1,3-thiazol-2-amine |
| SMILES | COc1c(OCCCC(C)(C)C)cccc1-c1csc(N)n1 |
| InChI | InChI=1S/C17H24N2O2S/c1-17(2,3)9-6-10-21-14-8-5-7-12(15(14)20-4)13-11-22-16(18)19-13/h5,7-8,11H,6,9-10H2,1-4H3,(H2,18,19) |
| InChIKey | OYLVEPVHSRUIKW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|