C21H23N — CID 87492364
2,2-dimethyl-1-[3-(3-methylcyclopenta-1,3-dien-1-yl)naphthalen-2-yl]propan-1-imine (PubChem CID 87492364) has the molecular formula C21H23N and a molecular weight of 289.42 g/mol. Its IUPAC name is 2,2-dimethyl-1-[3-(3-methylcyclopenta-1,3-dien-1-yl)naphthalen-2-yl]propan-1-imine.
| Compound Name | 2,2-dimethyl-1-[3-(3-methylcyclopenta-1,3-dien-1-yl)naphthalen-2-yl]propan-1-imine |
|---|---|
| PubChem CID | 87492364 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 2,2-dimethyl-1-[3-(3-methylcyclopenta-1,3-dien-1-yl)naphthalen-2-yl]propan-1-imine |
| SMILES | [H]/N=C(/c1cc2ccccc2cc1C1=CC(C)=CC1)C(C)(C)C |
| InChI | InChI=1S/C21H23N/c1-14-9-10-17(11-14)18-12-15-7-5-6-8-16(15)13-19(18)20(22)21(2,3)4/h5-9,11-13,22H,10H2,1-4H3/b22-20- |
| InChIKey | IORXMVXBJVRRFS-XDOYNYLZSA-N |
| XLogP | 5.99 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|