C21H23N — CID 91005986
[3-[2-methyl-1-(3-methylcyclopenta-1,3-dien-1-yl)propan-2-yl]naphthalen-2-yl]methanimine (PubChem CID 91005986) has the molecular formula C21H23N and a molecular weight of 289.42 g/mol. Its IUPAC name is [3-[2-methyl-1-(3-methylcyclopenta-1,3-dien-1-yl)propan-2-yl]naphthalen-2-yl]methanimine.
| Compound Name | [3-[2-methyl-1-(3-methylcyclopenta-1,3-dien-1-yl)propan-2-yl]naphthalen-2-yl]methanimine |
|---|---|
| PubChem CID | 91005986 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | [3-[2-methyl-1-(3-methylcyclopenta-1,3-dien-1-yl)propan-2-yl]naphthalen-2-yl]methanimine |
| SMILES | [H]/N=C/c1cc2ccccc2cc1C(C)(C)CC1=CC(C)=CC1 |
| InChI | InChI=1S/C21H23N/c1-15-8-9-16(10-15)13-21(2,3)20-12-18-7-5-4-6-17(18)11-19(20)14-22/h4-8,10-12,14,22H,9,13H2,1-3H3/b22-14+ |
| InChIKey | SLKZRXRCPPXSAO-HYARGMPZSA-N |
| XLogP | 5.78 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|