About prop-2-enamide;3-prop-2-enoxyprop-1-ene;prop-2-enyl 2-hydroxyacetate
prop-2-enamide;3-prop-2-enoxyprop-1-ene;prop-2-enyl 2-hydroxyacetate (PubChem CID 87501236) has the molecular formula C14H23NO5
and a molecular weight of 285.34 g/mol. Its IUPAC name is prop-2-enamide;3-prop-2-enoxyprop-1-ene;prop-2-enyl 2-hydroxyacetate.
Molecular Properties
| Compound Name | prop-2-enamide;3-prop-2-enoxyprop-1-ene;prop-2-enyl 2-hydroxyacetate |
| PubChem CID | 87501236 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | prop-2-enamide;3-prop-2-enoxyprop-1-ene;prop-2-enyl 2-hydroxyacetate |
| SMILES | C=CC(N)=O.C=CCOC(=O)CO.C=CCOCC=C |
| InChI | InChI=1S/C6H10O.C5H8O3.C3H5NO/c1-3-5-7-6-4-2;1-2-3-8-5(7)4-6;1-2-3(4)5/h3-4H,1-2,5-6H2;2,6H,1,3-4H2;2H,1H2,(H2,4,5) |
| InChIKey | ZXSVOJJWIGUIRT-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enamide;3-prop-2-enoxyprop-1-ene;prop-2-enyl 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enamide;3-prop-2-enoxyprop-1-ene;prop-2-enyl 2-hydroxyacetate?
The IUPAC name of prop-2-enamide;3-prop-2-enoxyprop-1-ene;prop-2-enyl 2-hydroxyacetate (CID 87501236) is prop-2-enamide;3-prop-2-enoxyprop-1-ene;prop-2-enyl 2-hydroxyacetate.
What is the SMILES notation for prop-2-enamide;3-prop-2-enoxyprop-1-ene;prop-2-enyl 2-hydroxyacetate?
The canonical SMILES for prop-2-enamide;3-prop-2-enoxyprop-1-ene;prop-2-enyl 2-hydroxyacetate is C=CC(N)=O.C=CCOC(=O)CO.C=CCOCC=C.
What is the InChIKey of prop-2-enamide;3-prop-2-enoxyprop-1-ene;prop-2-enyl 2-hydroxyacetate?
The InChIKey is ZXSVOJJWIGUIRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O.C5H8O3.C3H5NO/c1-3-5-7-6-4-2;1-2-3-8-5(7)4-6;1-2-3(4)5/h3-4H,1-2,5-6H2;2,6H,1,3-4H2;2H,1H2,(H2,4,5).
What are the key properties of prop-2-enamide;3-prop-2-enoxyprop-1-ene;prop-2-enyl 2-hydroxyacetate?
prop-2-enamide;3-prop-2-enoxyprop-1-ene;prop-2-enyl 2-hydroxyacetate has a molecular weight of 285.34 g/mol, XLogP of 0.74, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enamide;3-prop-2-enoxyprop-1-ene;prop-2-enyl 2-hydroxyacetate is sourced from PubChem (CID 87501236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).