C6H11IO5 — CID 87512788
(2S,3S,4S,5R)-3,4,5,6-tetrahydroxy-2-iodohexanal (PubChem CID 87512788) has the molecular formula C6H11IO5 and a molecular weight of 290.05 g/mol. Its IUPAC name is (2S,3S,4S,5R)-3,4,5,6-tetrahydroxy-2-iodohexanal.
| Compound Name | (2S,3S,4S,5R)-3,4,5,6-tetrahydroxy-2-iodohexanal |
|---|---|
| PubChem CID | 87512788 |
| Molecular Formula | C6H11IO5 |
| Molecular Weight | 290.05 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | (2S,3S,4S,5R)-3,4,5,6-tetrahydroxy-2-iodohexanal |
| SMILES | O=C[C@@H](I)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H11IO5/c7-3(1-8)5(11)6(12)4(10)2-9/h1,3-6,9-12H,2H2/t3-,4-,5-,6+/m1/s1 |
| InChIKey | CEZAPBOOIGGEPC-KAZBKCHUSA-N |
| XLogP | -1.94 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.05 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|