C7H13NO6P+ — CID 87518903
[[(1S)-1,3-dicarboxypropyl]-ethylamino]-hydroxy-oxophosphanium (PubChem CID 87518903) has the molecular formula C7H13NO6P+ and a molecular weight of 238.16 g/mol. Its IUPAC name is [[(1S)-1,3-dicarboxypropyl]-ethylamino]-hydroxy-oxophosphanium.
| Compound Name | [[(1S)-1,3-dicarboxypropyl]-ethylamino]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 87518903 |
| Molecular Formula | C7H13NO6P+ |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | [[(1S)-1,3-dicarboxypropyl]-ethylamino]-hydroxy-oxophosphanium |
| SMILES | CCN([C@@H](CCC(=O)O)C(=O)O)[P+](=O)O |
| InChI | InChI=1S/C7H12NO6P/c1-2-8(15(13)14)5(7(11)12)3-4-6(9)10/h5H,2-4H2,1H3,(H2-,9,10,11,12,13,14)/p+1/t5-/m0/s1 |
| InChIKey | WOYLPEHDYGDTER-YFKPBYRVSA-O |
| XLogP | 0.28 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|