C36H36ClN7O2S — CID 87522024
N-[2-[4-[3-chloro-4-[(1,2-dibenzyl-1,2-thiazol-4-yl)oxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethyl]pyrrolidine-3-carboxamide (PubChem CID 87522024) has the molecular formula C36H36ClN7O2S and a molecular weight of 666.25 g/mol. Its IUPAC name is N-[2-[4-[3-chloro-4-[(1,2-dibenzyl-1,2-thiazol-4-yl)oxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethyl]pyrrolidine-3-carboxamide.
| Compound Name | N-[2-[4-[3-chloro-4-[(1,2-dibenzyl-1,2-thiazol-4-yl)oxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 87522024 |
| Molecular Formula | C36H36ClN7O2S |
| Molecular Weight | 666.25 g/mol |
| Exact Mass | 665.23 |
| IUPAC Name | N-[2-[4-[3-chloro-4-[(1,2-dibenzyl-1,2-thiazol-4-yl)oxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NCCn1ccc2ncnc(Nc3ccc(OC4=CN(Cc5ccccc5)S(Cc5ccccc5)=C4)c(Cl)c3)c21)C1CCNC1 |
| InChI | InChI=1S/C36H36ClN7O2S/c37-31-19-29(42-35-34-32(40-25-41-35)14-17-43(34)18-16-39-36(45)28-13-15-38-20-28)11-12-33(31)46-30-22-44(21-26-7-3-1-4-8-26)47(24-30)23-27-9-5-2-6-10-27/h1-12,14,17,19,22,24-25,28,38H,13,15-16,18,20-21,23H2,(H,39,45)(H,40,41,42) |
| InChIKey | FGBJIKIYBXVNDL-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.25 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|