C36H37ClN6O3S — CID 87522182
N-[2-[4-[3-chloro-4-[(1,2-dibenzyl-1,2-thiazol-4-yl)oxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethyl]-3-hydroxy-3-methylbutanamide (PubChem CID 87522182) has the molecular formula C36H37ClN6O3S and a molecular weight of 669.25 g/mol. Its IUPAC name is N-[2-[4-[3-chloro-4-[(1,2-dibenzyl-1,2-thiazol-4-yl)oxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethyl]-3-hydroxy-3-methylbutanamide.
| Compound Name | N-[2-[4-[3-chloro-4-[(1,2-dibenzyl-1,2-thiazol-4-yl)oxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethyl]-3-hydroxy-3-methylbutanamide |
|---|---|
| PubChem CID | 87522182 |
| Molecular Formula | C36H37ClN6O3S |
| Molecular Weight | 669.25 g/mol |
| Exact Mass | 668.23 |
| IUPAC Name | N-[2-[4-[3-chloro-4-[(1,2-dibenzyl-1,2-thiazol-4-yl)oxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethyl]-3-hydroxy-3-methylbutanamide |
| SMILES | CC(C)(O)CC(=O)NCCn1ccc2ncnc(Nc3ccc(OC4=CN(Cc5ccccc5)S(Cc5ccccc5)=C4)c(Cl)c3)c21 |
| InChI | InChI=1S/C36H37ClN6O3S/c1-36(2,45)20-33(44)38-16-18-42-17-15-31-34(42)35(40-25-39-31)41-28-13-14-32(30(37)19-28)46-29-22-43(21-26-9-5-3-6-10-26)47(24-29)23-27-11-7-4-8-12-27/h3-15,17,19,22,24-25,45H,16,18,20-21,23H2,1-2H3,(H,38,44)(H,39,40,41) |
| InChIKey | ZWNNAKXOTXXOJD-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.25 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|