C34H33FN6O4S2 — CID 87522394
N-[2-[4-[4-[(1,2-dibenzyl-1,2-thiazol-4-yl)oxy]-3-fluoroanilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethyl]-2-methylsulfonylacetamide (PubChem CID 87522394) has the molecular formula C34H33FN6O4S2 and a molecular weight of 672.81 g/mol. Its IUPAC name is N-[2-[4-[4-[(1,2-dibenzyl-1,2-thiazol-4-yl)oxy]-3-fluoroanilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethyl]-2-methylsulfonylacetamide.
| Compound Name | N-[2-[4-[4-[(1,2-dibenzyl-1,2-thiazol-4-yl)oxy]-3-fluoroanilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethyl]-2-methylsulfonylacetamide |
|---|---|
| PubChem CID | 87522394 |
| Molecular Formula | C34H33FN6O4S2 |
| Molecular Weight | 672.81 g/mol |
| Exact Mass | 672.20 |
| IUPAC Name | N-[2-[4-[4-[(1,2-dibenzyl-1,2-thiazol-4-yl)oxy]-3-fluoroanilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethyl]-2-methylsulfonylacetamide |
| SMILES | CS(=O)(=O)CC(=O)NCCn1ccc2ncnc(Nc3ccc(OC4=CN(Cc5ccccc5)S(Cc5ccccc5)=C4)c(F)c3)c21 |
| InChI | InChI=1S/C34H33FN6O4S2/c1-47(43,44)23-32(42)36-15-17-40-16-14-30-33(40)34(38-24-37-30)39-27-12-13-31(29(35)18-27)45-28-20-41(19-25-8-4-2-5-9-25)46(22-28)21-26-10-6-3-7-11-26/h2-14,16,18,20,22,24H,15,17,19,21,23H2,1H3,(H,36,42)(H,37,38,39) |
| InChIKey | QDOZPVJNURQUAY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.81 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|