C36H37ClN6O5S2 — CID 91217222
[1-[2-[4-[3-chloro-4-[(1,2-dibenzyl-1,2-thiazol-4-yl)oxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethylamino]-2-methyl-1-oxopropan-2-yl] methanesulfonate (PubChem CID 91217222) has the molecular formula C36H37ClN6O5S2 and a molecular weight of 733.32 g/mol. Its IUPAC name is [1-[2-[4-[3-chloro-4-[(1,2-dibenzyl-1,2-thiazol-4-yl)oxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethylamino]-2-methyl-1-oxopropan-2-yl] methanesulfonate.
| Compound Name | [1-[2-[4-[3-chloro-4-[(1,2-dibenzyl-1,2-thiazol-4-yl)oxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethylamino]-2-methyl-1-oxopropan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 91217222 |
| Molecular Formula | C36H37ClN6O5S2 |
| Molecular Weight | 733.32 g/mol |
| Exact Mass | 732.20 |
| IUPAC Name | [1-[2-[4-[3-chloro-4-[(1,2-dibenzyl-1,2-thiazol-4-yl)oxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethylamino]-2-methyl-1-oxopropan-2-yl] methanesulfonate |
| SMILES | CC(C)(OS(C)(=O)=O)C(=O)NCCn1ccc2ncnc(Nc3ccc(OC4=CN(Cc5ccccc5)S(Cc5ccccc5)=C4)c(Cl)c3)c21 |
| InChI | InChI=1S/C36H37ClN6O5S2/c1-36(2,48-50(3,45)46)35(44)38-17-19-42-18-16-31-33(42)34(40-25-39-31)41-28-14-15-32(30(37)20-28)47-29-22-43(21-26-10-6-4-7-11-26)49(24-29)23-27-12-8-5-9-13-27/h4-16,18,20,22,24-25H,17,19,21,23H2,1-3H3,(H,38,44)(H,39,40,41) |
| InChIKey | UUKRAUNIBGPYEG-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.32 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|