C33H31BrN6O2S — CID 87522533
N-[2-[4-[3-bromo-4-[(1,2-dibenzyl-1,2-thiazol-4-yl)oxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethyl]acetamide (PubChem CID 87522533) has the molecular formula C33H31BrN6O2S and a molecular weight of 655.62 g/mol. Its IUPAC name is N-[2-[4-[3-bromo-4-[(1,2-dibenzyl-1,2-thiazol-4-yl)oxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethyl]acetamide.
| Compound Name | N-[2-[4-[3-bromo-4-[(1,2-dibenzyl-1,2-thiazol-4-yl)oxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 87522533 |
| Molecular Formula | C33H31BrN6O2S |
| Molecular Weight | 655.62 g/mol |
| Exact Mass | 654.14 |
| IUPAC Name | N-[2-[4-[3-bromo-4-[(1,2-dibenzyl-1,2-thiazol-4-yl)oxy]anilino]pyrrolo[3,2-d]pyrimidin-5-yl]ethyl]acetamide |
| SMILES | CC(=O)NCCn1ccc2ncnc(Nc3ccc(OC4=CN(Cc5ccccc5)S(Cc5ccccc5)=C4)c(Br)c3)c21 |
| InChI | InChI=1S/C33H31BrN6O2S/c1-24(41)35-15-17-39-16-14-30-32(39)33(37-23-36-30)38-27-12-13-31(29(34)18-27)42-28-20-40(19-25-8-4-2-5-9-25)43(22-28)21-26-10-6-3-7-11-26/h2-14,16,18,20,22-23H,15,17,19,21H2,1H3,(H,35,41)(H,36,37,38) |
| InChIKey | NUNRQOXWJDFJCJ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.62 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|