C31H49N3O9 — CID 87548415
bis[2-(aziridin-2-yl)ethyl] 4-[3-[2-(aziridin-2-yl)ethoxy]-3-oxoprop-1-enyl]-4-[4-hydroxy-3,3-bis(1-hydroxyethyl)pentyl]hepta-2,5-dienedioate (PubChem CID 87548415) has the molecular formula C31H49N3O9 and a molecular weight of 607.75 g/mol. Its IUPAC name is bis[2-(aziridin-2-yl)ethyl] 4-[3-[2-(aziridin-2-yl)ethoxy]-3-oxoprop-1-enyl]-4-[4-hydroxy-3,3-bis(1-hydroxyethyl)pentyl]hepta-2,5-dienedioate.
| Compound Name | bis[2-(aziridin-2-yl)ethyl] 4-[3-[2-(aziridin-2-yl)ethoxy]-3-oxoprop-1-enyl]-4-[4-hydroxy-3,3-bis(1-hydroxyethyl)pentyl]hepta-2,5-dienedioate |
|---|---|
| PubChem CID | 87548415 |
| Molecular Formula | C31H49N3O9 |
| Molecular Weight | 607.75 g/mol |
| Exact Mass | 607.35 |
| IUPAC Name | bis[2-(aziridin-2-yl)ethyl] 4-[3-[2-(aziridin-2-yl)ethoxy]-3-oxoprop-1-enyl]-4-[4-hydroxy-3,3-bis(1-hydroxyethyl)pentyl]hepta-2,5-dienedioate |
| SMILES | CC(O)C(CCC(C=CC(=O)OCCC1CN1)(C=CC(=O)OCCC1CN1)C=CC(=O)OCCC1CN1)(C(C)O)C(C)O |
| InChI | InChI=1S/C31H49N3O9/c1-21(35)31(22(2)36,23(3)37)14-13-30(10-4-27(38)41-15-7-24-18-32-24,11-5-28(39)42-16-8-25-19-33-25)12-6-29(40)43-17-9-26-20-34-26/h4-6,10-12,21-26,32-37H,7-9,13-20H2,1-3H3 |
| InChIKey | FIMLMXUYLBQDNT-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 205.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.75 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|