About [1-carboxy-2-(2,6-difluorophenyl)-2-oxoethylidene]-iminoazanium
[1-carboxy-2-(2,6-difluorophenyl)-2-oxoethylidene]-iminoazanium (PubChem CID 87562327) has the molecular formula C9H5F2N2O3+
and a molecular weight of 227.15 g/mol. Its IUPAC name is [1-carboxy-2-(2,6-difluorophenyl)-2-oxoethylidene]-iminoazanium.
Molecular Properties
| Compound Name | [1-carboxy-2-(2,6-difluorophenyl)-2-oxoethylidene]-iminoazanium |
| PubChem CID | 87562327 |
| Molecular Formula | C9H5F2N2O3+ |
| Molecular Weight | 227.15 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | [1-carboxy-2-(2,6-difluorophenyl)-2-oxoethylidene]-iminoazanium |
| SMILES | N=[N+]=C(C(=O)O)C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C9H4F2N2O3/c10-4-2-1-3-5(11)6(4)8(14)7(13-12)9(15)16/h1-3,12H/p+1 |
| InChIKey | DGVNGHBYYOSYGX-UHFFFAOYSA-O |
| XLogP | 0.91 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.15 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [1-carboxy-2-(2,6-difluorophenyl)-2-oxoethylidene]-iminoazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-carboxy-2-(2,6-difluorophenyl)-2-oxoethylidene]-iminoazanium?
The IUPAC name of [1-carboxy-2-(2,6-difluorophenyl)-2-oxoethylidene]-iminoazanium (CID 87562327) is [1-carboxy-2-(2,6-difluorophenyl)-2-oxoethylidene]-iminoazanium.
What is the SMILES notation for [1-carboxy-2-(2,6-difluorophenyl)-2-oxoethylidene]-iminoazanium?
The canonical SMILES for [1-carboxy-2-(2,6-difluorophenyl)-2-oxoethylidene]-iminoazanium is N=[N+]=C(C(=O)O)C(=O)c1c(F)cccc1F.
What is the InChIKey of [1-carboxy-2-(2,6-difluorophenyl)-2-oxoethylidene]-iminoazanium?
The InChIKey is DGVNGHBYYOSYGX-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H4F2N2O3/c10-4-2-1-3-5(11)6(4)8(14)7(13-12)9(15)16/h1-3,12H/p+1.
What are the key properties of [1-carboxy-2-(2,6-difluorophenyl)-2-oxoethylidene]-iminoazanium?
[1-carboxy-2-(2,6-difluorophenyl)-2-oxoethylidene]-iminoazanium has a molecular weight of 227.15 g/mol, XLogP of 0.91, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-carboxy-2-(2,6-difluorophenyl)-2-oxoethylidene]-iminoazanium is sourced from PubChem (CID 87562327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).