C27H18N8 — CID 87572832
N-(3-ethynylphenyl)-7-methyl-8-[3-(7H-purin-6-yl)-2-pyridinyl]quinazolin-4-amine (PubChem CID 87572832) has the molecular formula C27H18N8 and a molecular weight of 454.50 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-7-methyl-8-[3-(7H-purin-6-yl)-2-pyridinyl]quinazolin-4-amine.
| Compound Name | N-(3-ethynylphenyl)-7-methyl-8-[3-(7H-purin-6-yl)-2-pyridinyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 87572832 |
| Molecular Formula | C27H18N8 |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | N-(3-ethynylphenyl)-7-methyl-8-[3-(7H-purin-6-yl)-2-pyridinyl]quinazolin-4-amine |
| SMILES | C#Cc1cccc(Nc2ncnc3c(-c4ncccc4-c4ncnc5nc[nH]c45)c(C)ccc23)c1 |
| InChI | InChI=1S/C27H18N8/c1-3-17-6-4-7-18(12-17)35-26-20-10-9-16(2)21(23(20)29-13-32-26)22-19(8-5-11-28-22)24-25-27(33-14-30-24)34-15-31-25/h1,4-15H,2H3,(H,29,32,35)(H,30,31,33,34) |
| InChIKey | CHGUJQXWRYEVQC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 105.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|