C11H15F5O4 — CID 87574398
2-methyl-4-[2-(2,2,3,3,3-pentafluoropropoxy)ethoxy]pent-2-enoic acid (PubChem CID 87574398) has the molecular formula C11H15F5O4 and a molecular weight of 306.23 g/mol. Its IUPAC name is 2-methyl-4-[2-(2,2,3,3,3-pentafluoropropoxy)ethoxy]pent-2-enoic acid.
| Compound Name | 2-methyl-4-[2-(2,2,3,3,3-pentafluoropropoxy)ethoxy]pent-2-enoic acid |
|---|---|
| PubChem CID | 87574398 |
| Molecular Formula | C11H15F5O4 |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 2-methyl-4-[2-(2,2,3,3,3-pentafluoropropoxy)ethoxy]pent-2-enoic acid |
| SMILES | CC(=CC(C)OCCOCC(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C11H15F5O4/c1-7(9(17)18)5-8(2)20-4-3-19-6-10(12,13)11(14,15)16/h5,8H,3-4,6H2,1-2H3,(H,17,18) |
| InChIKey | KHBMIBPAHDJFDS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|