C18H25F3N2O3 — CID 87583063
5-[3-[3-hydroxy-3-[(2,2,2-trifluoroacetyl)amino]propyl]phenyl]-N,N-dimethylpentanamide (PubChem CID 87583063) has the molecular formula C18H25F3N2O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is 5-[3-[3-hydroxy-3-[(2,2,2-trifluoroacetyl)amino]propyl]phenyl]-N,N-dimethylpentanamide.
| Compound Name | 5-[3-[3-hydroxy-3-[(2,2,2-trifluoroacetyl)amino]propyl]phenyl]-N,N-dimethylpentanamide |
|---|---|
| PubChem CID | 87583063 |
| Molecular Formula | C18H25F3N2O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 5-[3-[3-hydroxy-3-[(2,2,2-trifluoroacetyl)amino]propyl]phenyl]-N,N-dimethylpentanamide |
| SMILES | CN(C)C(=O)CCCCc1cccc(CCC(O)NC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C18H25F3N2O3/c1-23(2)16(25)9-4-3-6-13-7-5-8-14(12-13)10-11-15(24)22-17(26)18(19,20)21/h5,7-8,12,15,24H,3-4,6,9-11H2,1-2H3,(H,22,26) |
| InChIKey | CSLIYRJEGVHXSL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|