C26H28F5N5O4S — CID 87596442
4-benzyl-3-oxo-2-propan-2-yl-1,4,8-triazaspiro[4.5]decane-8-carbothioic S-acid;2-N,3,4,5,6-pentafluorobenzene-1,2-dicarboxamide (PubChem CID 87596442) has the molecular formula C26H28F5N5O4S and a molecular weight of 601.60 g/mol. Its IUPAC name is 4-benzyl-3-oxo-2-propan-2-yl-1,4,8-triazaspiro[4.5]decane-8-carbothioic S-acid;2-N,3,4,5,6-pentafluorobenzene-1,2-dicarboxamide.
| Compound Name | 4-benzyl-3-oxo-2-propan-2-yl-1,4,8-triazaspiro[4.5]decane-8-carbothioic S-acid;2-N,3,4,5,6-pentafluorobenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 87596442 |
| Molecular Formula | C26H28F5N5O4S |
| Molecular Weight | 601.60 g/mol |
| Exact Mass | 601.18 |
| IUPAC Name | 4-benzyl-3-oxo-2-propan-2-yl-1,4,8-triazaspiro[4.5]decane-8-carbothioic S-acid;2-N,3,4,5,6-pentafluorobenzene-1,2-dicarboxamide |
| SMILES | CC(C)C1NC2(CCN(C(=O)S)CC2)N(Cc2ccccc2)C1=O.NC(=O)c1c(F)c(F)c(F)c(F)c1C(=O)NF |
| InChI | InChI=1S/C18H25N3O2S.C8H3F5N2O2/c1-13(2)15-16(22)21(12-14-6-4-3-5-7-14)18(19-15)8-10-20(11-9-18)17(23)24;9-3-1(7(14)16)2(8(17)15-13)4(10)6(12)5(3)11/h3-7,13,15,19H,8-12H2,1-2H3,(H,23,24);(H2,14,16)(H,15,17) |
| InChIKey | ALPRIERDNIBJQJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.60 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|