C21H31Cl2N3O2S — CID 157375553
4-butyl-3-oxo-2-propan-2-yl-1,4,8-triazaspiro[4.5]decane-8-carbothioic S-acid;1,4-dichlorobenzene (PubChem CID 157375553) has the molecular formula C21H31Cl2N3O2S and a molecular weight of 460.47 g/mol. Its IUPAC name is 4-butyl-3-oxo-2-propan-2-yl-1,4,8-triazaspiro[4.5]decane-8-carbothioic S-acid;1,4-dichlorobenzene.
| Compound Name | 4-butyl-3-oxo-2-propan-2-yl-1,4,8-triazaspiro[4.5]decane-8-carbothioic S-acid;1,4-dichlorobenzene |
|---|---|
| PubChem CID | 157375553 |
| Molecular Formula | C21H31Cl2N3O2S |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 4-butyl-3-oxo-2-propan-2-yl-1,4,8-triazaspiro[4.5]decane-8-carbothioic S-acid;1,4-dichlorobenzene |
| SMILES | CCCCN1C(=O)C(C(C)C)NC12CCN(C(=O)S)CC2.Clc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H27N3O2S.C6H4Cl2/c1-4-5-8-18-13(19)12(11(2)3)16-15(18)6-9-17(10-7-15)14(20)21;7-5-1-2-6(8)4-3-5/h11-12,16H,4-10H2,1-3H3,(H,20,21);1-4H |
| InChIKey | BKHCCHBJERLUTL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|