C18H16BrFO5 — CID 87612992
2-bromo-2-[3-fluoro-4-(3,4,5-trimethoxybenzoyl)phenyl]acetaldehyde (PubChem CID 87612992) has the molecular formula C18H16BrFO5 and a molecular weight of 411.22 g/mol. Its IUPAC name is 2-bromo-2-[3-fluoro-4-(3,4,5-trimethoxybenzoyl)phenyl]acetaldehyde.
| Compound Name | 2-bromo-2-[3-fluoro-4-(3,4,5-trimethoxybenzoyl)phenyl]acetaldehyde |
|---|---|
| PubChem CID | 87612992 |
| Molecular Formula | C18H16BrFO5 |
| Molecular Weight | 411.22 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | 2-bromo-2-[3-fluoro-4-(3,4,5-trimethoxybenzoyl)phenyl]acetaldehyde |
| SMILES | COc1cc(C(=O)c2ccc(C(Br)C=O)cc2F)cc(OC)c1OC |
| InChI | InChI=1S/C18H16BrFO5/c1-23-15-7-11(8-16(24-2)18(15)25-3)17(22)12-5-4-10(6-14(12)20)13(19)9-21/h4-9,13H,1-3H3 |
| InChIKey | WJGUIJBXILQDIQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.22 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|