C10H10ClN3O3 — CID 87621136
ethyl 4-chloro-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboperoxoate (PubChem CID 87621136) has the molecular formula C10H10ClN3O3 and a molecular weight of 255.66 g/mol. Its IUPAC name is ethyl 4-chloro-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboperoxoate.
| Compound Name | ethyl 4-chloro-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboperoxoate |
|---|---|
| PubChem CID | 87621136 |
| Molecular Formula | C10H10ClN3O3 |
| Molecular Weight | 255.66 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | ethyl 4-chloro-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboperoxoate |
| SMILES | CCOOC(=O)c1cn2ncnc(Cl)c2c1C |
| InChI | InChI=1S/C10H10ClN3O3/c1-3-16-17-10(15)7-4-14-8(6(7)2)9(11)12-5-13-14/h4-5H,3H2,1-2H3 |
| InChIKey | PVYMSZSSYRYYOB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.66 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|