About [(N'-cyanocarbamimidoyl)amino] perchlorate
[(N'-cyanocarbamimidoyl)amino] perchlorate (PubChem CID 87628145) has the molecular formula C2H3ClN4O4
and a molecular weight of 182.52 g/mol. Its IUPAC name is [(N'-cyanocarbamimidoyl)amino] perchlorate.
Molecular Properties
| Compound Name | [(N'-cyanocarbamimidoyl)amino] perchlorate |
| PubChem CID | 87628145 |
| Molecular Formula | C2H3ClN4O4 |
| Molecular Weight | 182.52 g/mol |
| Exact Mass | 181.98 |
| IUPAC Name | [(N'-cyanocarbamimidoyl)amino] perchlorate |
| SMILES | N#C/N=C(\N)NO[Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C2H3ClN4O4/c4-1-6-2(5)7-11-3(8,9)10/h(H3,5,6,7) |
| InChIKey | GBHNYJCWKXDZFK-UHFFFAOYSA-N |
| XLogP | -4.80 |
| TPSA | 152.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.52 |
| LogP ≤ 5 | -4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(N'-cyanocarbamimidoyl)amino] perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(N'-cyanocarbamimidoyl)amino] perchlorate?
The IUPAC name of [(N'-cyanocarbamimidoyl)amino] perchlorate (CID 87628145) is [(N'-cyanocarbamimidoyl)amino] perchlorate.
What is the SMILES notation for [(N'-cyanocarbamimidoyl)amino] perchlorate?
The canonical SMILES for [(N'-cyanocarbamimidoyl)amino] perchlorate is N#C/N=C(\N)NO[Cl+3]([O-])([O-])[O-].
What is the InChIKey of [(N'-cyanocarbamimidoyl)amino] perchlorate?
The InChIKey is GBHNYJCWKXDZFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3ClN4O4/c4-1-6-2(5)7-11-3(8,9)10/h(H3,5,6,7).
What are the key properties of [(N'-cyanocarbamimidoyl)amino] perchlorate?
[(N'-cyanocarbamimidoyl)amino] perchlorate has a molecular weight of 182.52 g/mol, XLogP of -4.80, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(N'-cyanocarbamimidoyl)amino] perchlorate is sourced from PubChem (CID 87628145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).