C19H23F3N4OS — CID 87637179
(1Z)-1-[5-methyl-3-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-ylidene]-3-(3-pyrrolidin-1-ylpropyl)urea (PubChem CID 87637179) has the molecular formula C19H23F3N4OS and a molecular weight of 412.48 g/mol. Its IUPAC name is (1Z)-1-[5-methyl-3-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-ylidene]-3-(3-pyrrolidin-1-ylpropyl)urea.
| Compound Name | (1Z)-1-[5-methyl-3-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-ylidene]-3-(3-pyrrolidin-1-ylpropyl)urea |
|---|---|
| PubChem CID | 87637179 |
| Molecular Formula | C19H23F3N4OS |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (1Z)-1-[5-methyl-3-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-ylidene]-3-(3-pyrrolidin-1-ylpropyl)urea |
| SMILES | Cc1cn(-c2ccc(C(F)(F)F)cc2)/c(=N/C(=O)NCCCN2CCCC2)s1 |
| InChI | InChI=1S/C19H23F3N4OS/c1-14-13-26(16-7-5-15(6-8-16)19(20,21)22)18(28-14)24-17(27)23-9-4-12-25-10-2-3-11-25/h5-8,13H,2-4,9-12H2,1H3,(H,23,27)/b24-18- |
| InChIKey | IHJCASRFPDMYOC-MOHJPFBDSA-N |
| XLogP | 3.96 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|