C27H39N5O5 — CID 87638179
N-[(1S)-1-[5-[(1,3-benzodioxol-5-ylmethylamino)methyl]-1H-imidazol-2-yl]-2,2-dimethylpropyl]-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanamide (PubChem CID 87638179) has the molecular formula C27H39N5O5 and a molecular weight of 513.64 g/mol. Its IUPAC name is N-[(1S)-1-[5-[(1,3-benzodioxol-5-ylmethylamino)methyl]-1H-imidazol-2-yl]-2,2-dimethylpropyl]-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanamide.
| Compound Name | N-[(1S)-1-[5-[(1,3-benzodioxol-5-ylmethylamino)methyl]-1H-imidazol-2-yl]-2,2-dimethylpropyl]-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanamide |
|---|---|
| PubChem CID | 87638179 |
| Molecular Formula | C27H39N5O5 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | N-[(1S)-1-[5-[(1,3-benzodioxol-5-ylmethylamino)methyl]-1H-imidazol-2-yl]-2,2-dimethylpropyl]-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanamide |
| SMILES | CC(C)(C)[C@H](NC(=O)C(CC1CCCC1)CN(O)C=O)c1ncc(CNCc2ccc3c(c2)OCO3)[nH]1 |
| InChI | InChI=1S/C27H39N5O5/c1-27(2,3)24(31-26(34)20(15-32(35)16-33)10-18-6-4-5-7-18)25-29-14-21(30-25)13-28-12-19-8-9-22-23(11-19)37-17-36-22/h8-9,11,14,16,18,20,24,28,35H,4-7,10,12-13,15,17H2,1-3H3,(H,29,30)(H,31,34)/t20?,24-/m1/s1 |
| InChIKey | JRLYZLJJAQTVQT-PIFIWZBESA-N |
| XLogP | 3.68 |
| TPSA | 128.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|