C26H41N5O3 — CID 87639468
2-(cyclopentylmethyl)-N-[(1S)-1-[6-[(dimethylamino)methyl]-1-methylbenzimidazol-2-yl]-2,2-dimethylpropyl]-3-[formyl(hydroxy)amino]propanamide (PubChem CID 87639468) has the molecular formula C26H41N5O3 and a molecular weight of 471.65 g/mol. Its IUPAC name is 2-(cyclopentylmethyl)-N-[(1S)-1-[6-[(dimethylamino)methyl]-1-methylbenzimidazol-2-yl]-2,2-dimethylpropyl]-3-[formyl(hydroxy)amino]propanamide.
| Compound Name | 2-(cyclopentylmethyl)-N-[(1S)-1-[6-[(dimethylamino)methyl]-1-methylbenzimidazol-2-yl]-2,2-dimethylpropyl]-3-[formyl(hydroxy)amino]propanamide |
|---|---|
| PubChem CID | 87639468 |
| Molecular Formula | C26H41N5O3 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.32 |
| IUPAC Name | 2-(cyclopentylmethyl)-N-[(1S)-1-[6-[(dimethylamino)methyl]-1-methylbenzimidazol-2-yl]-2,2-dimethylpropyl]-3-[formyl(hydroxy)amino]propanamide |
| SMILES | CN(C)Cc1ccc2nc([C@@H](NC(=O)C(CC3CCCC3)CN(O)C=O)C(C)(C)C)n(C)c2c1 |
| InChI | InChI=1S/C26H41N5O3/c1-26(2,3)23(24-27-21-12-11-19(15-29(4)5)14-22(21)30(24)6)28-25(33)20(16-31(34)17-32)13-18-9-7-8-10-18/h11-12,14,17-18,20,23,34H,7-10,13,15-16H2,1-6H3,(H,28,33)/t20?,23-/m1/s1 |
| InChIKey | GEJUJMMEUYBQET-GWQXNCQPSA-N |
| XLogP | 3.88 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|