C23H32N4O4 — CID 10216622
(2R)-2-(cyclopentylmethyl)-N-[(1S)-2,2-dimethyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)propyl]-3-[formyl(hydroxy)amino]propanamide (PubChem CID 10216622) has the molecular formula C23H32N4O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is (2R)-2-(cyclopentylmethyl)-N-[(1S)-2,2-dimethyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)propyl]-3-[formyl(hydroxy)amino]propanamide.
| Compound Name | (2R)-2-(cyclopentylmethyl)-N-[(1S)-2,2-dimethyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)propyl]-3-[formyl(hydroxy)amino]propanamide |
|---|---|
| PubChem CID | 10216622 |
| Molecular Formula | C23H32N4O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | (2R)-2-(cyclopentylmethyl)-N-[(1S)-2,2-dimethyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)propyl]-3-[formyl(hydroxy)amino]propanamide |
| SMILES | CC(C)(C)[C@H](NC(=O)[C@H](CC1CCCC1)CN(O)C=O)c1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C23H32N4O4/c1-23(2,3)19(22-25-20(26-31-22)17-11-5-4-6-12-17)24-21(29)18(14-27(30)15-28)13-16-9-7-8-10-16/h4-6,11-12,15-16,18-19,30H,7-10,13-14H2,1-3H3,(H,24,29)/t18-,19-/m1/s1 |
| InChIKey | WQSZQRYPRJQPCG-RTBURBONSA-N |
| XLogP | 3.98 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|