C30H43N5O5 — CID 87638180
3-cyclopentyl-N-[3-[5-[[[1-(1,3-dioxol-4-yl)-2-phenylethyl]amino]methyl]-1H-imidazol-2-yl]-2,2-dimethylpropyl]-4-[formyl(hydroxy)amino]butanamide (PubChem CID 87638180) has the molecular formula C30H43N5O5 and a molecular weight of 553.70 g/mol. Its IUPAC name is 3-cyclopentyl-N-[3-[5-[[[1-(1,3-dioxol-4-yl)-2-phenylethyl]amino]methyl]-1H-imidazol-2-yl]-2,2-dimethylpropyl]-4-[formyl(hydroxy)amino]butanamide.
| Compound Name | 3-cyclopentyl-N-[3-[5-[[[1-(1,3-dioxol-4-yl)-2-phenylethyl]amino]methyl]-1H-imidazol-2-yl]-2,2-dimethylpropyl]-4-[formyl(hydroxy)amino]butanamide |
|---|---|
| PubChem CID | 87638180 |
| Molecular Formula | C30H43N5O5 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.33 |
| IUPAC Name | 3-cyclopentyl-N-[3-[5-[[[1-(1,3-dioxol-4-yl)-2-phenylethyl]amino]methyl]-1H-imidazol-2-yl]-2,2-dimethylpropyl]-4-[formyl(hydroxy)amino]butanamide |
| SMILES | CC(C)(CNC(=O)CC(CN(O)C=O)C1CCCC1)Cc1ncc(CNC(Cc2ccccc2)C2=COCO2)[nH]1 |
| InChI | InChI=1S/C30H43N5O5/c1-30(2,19-33-29(37)13-24(17-35(38)20-36)23-10-6-7-11-23)14-28-32-16-25(34-28)15-31-26(27-18-39-21-40-27)12-22-8-4-3-5-9-22/h3-5,8-9,16,18,20,23-24,26,31,38H,6-7,10-15,17,19,21H2,1-2H3,(H,32,34)(H,33,37) |
| InChIKey | FRNCBSBZVIFJPF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 128.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|