C23H27ClFN5O3S — CID 87639729
O-(3-piperidin-1-ylpropylamino) N-[[2-chloro-4-[(2-fluorobenzoyl)amino]benzoyl]amino]carbamothioate (PubChem CID 87639729) has the molecular formula C23H27ClFN5O3S and a molecular weight of 508.02 g/mol. Its IUPAC name is O-(3-piperidin-1-ylpropylamino) N-[[2-chloro-4-[(2-fluorobenzoyl)amino]benzoyl]amino]carbamothioate.
| Compound Name | O-(3-piperidin-1-ylpropylamino) N-[[2-chloro-4-[(2-fluorobenzoyl)amino]benzoyl]amino]carbamothioate |
|---|---|
| PubChem CID | 87639729 |
| Molecular Formula | C23H27ClFN5O3S |
| Molecular Weight | 508.02 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | O-(3-piperidin-1-ylpropylamino) N-[[2-chloro-4-[(2-fluorobenzoyl)amino]benzoyl]amino]carbamothioate |
| SMILES | O=C(Nc1ccc(C(=O)NNC(=S)ONCCCN2CCCCC2)c(Cl)c1)c1ccccc1F |
| InChI | InChI=1S/C23H27ClFN5O3S/c24-19-15-16(27-21(31)18-7-2-3-8-20(18)25)9-10-17(19)22(32)28-29-23(34)33-26-11-6-14-30-12-4-1-5-13-30/h2-3,7-10,15,26H,1,4-6,11-14H2,(H,27,31)(H,28,32)(H,29,34) |
| InChIKey | RNVZIWAMMJKPDQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.02 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|