C12H11ClN6O — CID 87640710
4-[4-chloro-1-(cyclopropylmethyl)imidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine (PubChem CID 87640710) has the molecular formula C12H11ClN6O and a molecular weight of 290.71 g/mol. Its IUPAC name is 4-[4-chloro-1-(cyclopropylmethyl)imidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-[4-chloro-1-(cyclopropylmethyl)imidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 87640710 |
| Molecular Formula | C12H11ClN6O |
| Molecular Weight | 290.71 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 4-[4-chloro-1-(cyclopropylmethyl)imidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine |
| SMILES | Nc1nonc1-c1nc2c(Cl)nccc2n1CC1CC1 |
| InChI | InChI=1S/C12H11ClN6O/c13-10-8-7(3-4-15-10)19(5-6-1-2-6)12(16-8)9-11(14)18-20-17-9/h3-4,6H,1-2,5H2,(H2,14,18) |
| InChIKey | AMZWNUKYRXHTTF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.71 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|