C15H36N4 — CID 87644047
1-N,1-N,4-N',4-N',8-N,8-N,5-heptamethyloctane-1,4,4,8-tetramine (PubChem CID 87644047) has the molecular formula C15H36N4 and a molecular weight of 272.48 g/mol. Its IUPAC name is 1-N,1-N,4-N',4-N',8-N,8-N,5-heptamethyloctane-1,4,4,8-tetramine.
| Compound Name | 1-N,1-N,4-N',4-N',8-N,8-N,5-heptamethyloctane-1,4,4,8-tetramine |
|---|---|
| PubChem CID | 87644047 |
| Molecular Formula | C15H36N4 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.29 |
| IUPAC Name | 1-N,1-N,4-N',4-N',8-N,8-N,5-heptamethyloctane-1,4,4,8-tetramine |
| SMILES | CC(CCCN(C)C)C(N)(CCCN(C)C)N(C)C |
| InChI | InChI=1S/C15H36N4/c1-14(10-8-12-17(2)3)15(16,19(6)7)11-9-13-18(4)5/h14H,8-13,16H2,1-7H3 |
| InChIKey | WTWLUHYDUDLMFJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|