C28H30FN5O — CID 87655074
8-[4-(1-fluoro-2-quinolin-8-ylpiperidin-4-yl)piperazin-1-yl]-2-methoxyquinoline (PubChem CID 87655074) has the molecular formula C28H30FN5O and a molecular weight of 471.58 g/mol. Its IUPAC name is 8-[4-(1-fluoro-2-quinolin-8-ylpiperidin-4-yl)piperazin-1-yl]-2-methoxyquinoline.
| Compound Name | 8-[4-(1-fluoro-2-quinolin-8-ylpiperidin-4-yl)piperazin-1-yl]-2-methoxyquinoline |
|---|---|
| PubChem CID | 87655074 |
| Molecular Formula | C28H30FN5O |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 8-[4-(1-fluoro-2-quinolin-8-ylpiperidin-4-yl)piperazin-1-yl]-2-methoxyquinoline |
| SMILES | COc1ccc2cccc(N3CCN(C4CCN(F)C(c5cccc6cccnc56)C4)CC3)c2n1 |
| InChI | InChI=1S/C28H30FN5O/c1-35-26-11-10-21-6-3-9-24(28(21)31-26)33-17-15-32(16-18-33)22-12-14-34(29)25(19-22)23-8-2-5-20-7-4-13-30-27(20)23/h2-11,13,22,25H,12,14-19H2,1H3 |
| InChIKey | NCYHVGYHCPWCPQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|