C11H14F2N2O2S — CID 87656202
1-tert-butyl-3-(3,5-difluoro-4-hydroxyphenyl)-1-sulfanylurea (PubChem CID 87656202) has the molecular formula C11H14F2N2O2S and a molecular weight of 276.31 g/mol. Its IUPAC name is 1-tert-butyl-3-(3,5-difluoro-4-hydroxyphenyl)-1-sulfanylurea.
| Compound Name | 1-tert-butyl-3-(3,5-difluoro-4-hydroxyphenyl)-1-sulfanylurea |
|---|---|
| PubChem CID | 87656202 |
| Molecular Formula | C11H14F2N2O2S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 1-tert-butyl-3-(3,5-difluoro-4-hydroxyphenyl)-1-sulfanylurea |
| SMILES | CC(C)(C)N(S)C(=O)Nc1cc(F)c(O)c(F)c1 |
| InChI | InChI=1S/C11H14F2N2O2S/c1-11(2,3)15(18)10(17)14-6-4-7(12)9(16)8(13)5-6/h4-5,16,18H,1-3H3,(H,14,17) |
| InChIKey | NVPDJVXRKQCKHN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|