2-[2-(2-chloro-2-oxoethoxy)cyclopentyl]oxyacetyl chloride

C9H12Cl2O4 — CID 87657847

IUPAC2-[2-(2-chloro-2-oxoethoxy)cyclopentyl]oxyacetyl chloride
SMILESO=C(Cl)COC1CCCC1OCC(=O)Cl
InChIInChI=1S/C9H12Cl2O4/c10-8(12)4-14-6-2-1-3-7(6)15-5-9(11)13/h6-7H,1-5H2
InChIKeyOMJWAUSDLLHCNF-UHFFFAOYSA-N
MW255.10 g/mol
LogP1.47
Rot. Bonds6

About 2-[2-(2-chloro-2-oxoethoxy)cyclopentyl]oxyacetyl chloride

2-[2-(2-chloro-2-oxoethoxy)cyclopentyl]oxyacetyl chloride (PubChem CID 87657847) has the molecular formula C9H12Cl2O4 and a molecular weight of 255.10 g/mol. Its IUPAC name is 2-[2-(2-chloro-2-oxoethoxy)cyclopentyl]oxyacetyl chloride.

Molecular Properties

Compound Name2-[2-(2-chloro-2-oxoethoxy)cyclopentyl]oxyacetyl chloride
PubChem CID87657847
Molecular FormulaC9H12Cl2O4
Molecular Weight255.10 g/mol
Exact Mass254.01
IUPAC Name2-[2-(2-chloro-2-oxoethoxy)cyclopentyl]oxyacetyl chloride
SMILESO=C(Cl)COC1CCCC1OCC(=O)Cl
InChIInChI=1S/C9H12Cl2O4/c10-8(12)4-14-6-2-1-3-7(6)15-5-9(11)13/h6-7H,1-5H2
InChIKeyOMJWAUSDLLHCNF-UHFFFAOYSA-N
XLogP1.47
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.10
LogP ≤ 51.47
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-[2-(2-chloro-2-oxoethoxy)cyclopentyl]oxyacetyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2-chloro-2-oxoethoxy)cyclopentyl]oxyacetyl chloride?
The IUPAC name of 2-[2-(2-chloro-2-oxoethoxy)cyclopentyl]oxyacetyl chloride (CID 87657847) is 2-[2-(2-chloro-2-oxoethoxy)cyclopentyl]oxyacetyl chloride.
What is the SMILES notation for 2-[2-(2-chloro-2-oxoethoxy)cyclopentyl]oxyacetyl chloride?
The canonical SMILES for 2-[2-(2-chloro-2-oxoethoxy)cyclopentyl]oxyacetyl chloride is O=C(Cl)COC1CCCC1OCC(=O)Cl.
What is the InChIKey of 2-[2-(2-chloro-2-oxoethoxy)cyclopentyl]oxyacetyl chloride?
The InChIKey is OMJWAUSDLLHCNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12Cl2O4/c10-8(12)4-14-6-2-1-3-7(6)15-5-9(11)13/h6-7H,1-5H2.
What are the key properties of 2-[2-(2-chloro-2-oxoethoxy)cyclopentyl]oxyacetyl chloride?
2-[2-(2-chloro-2-oxoethoxy)cyclopentyl]oxyacetyl chloride has a molecular weight of 255.10 g/mol, XLogP of 1.47, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-chloro-2-oxoethoxy)cyclopentyl]oxyacetyl chloride is sourced from PubChem (CID 87657847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).