About chloropalladium(1+);diphenylphosphanylmethyl(diphenyl)phosphane
chloropalladium(1+);diphenylphosphanylmethyl(diphenyl)phosphane (PubChem CID 87662459) has the molecular formula C25H21ClP2Pd
and a molecular weight of 525.26 g/mol. Its IUPAC name is chloropalladium(1+);diphenylphosphanylmethyl(diphenyl)phosphane.
Molecular Properties
| Compound Name | chloropalladium(1+);diphenylphosphanylmethyl(diphenyl)phosphane |
| PubChem CID | 87662459 |
| Molecular Formula | C25H21ClP2Pd |
| Molecular Weight | 525.26 g/mol |
| Exact Mass | 523.98 |
| IUPAC Name | chloropalladium(1+);diphenylphosphanylmethyl(diphenyl)phosphane |
| SMILES | Cl[Pd+].c1ccc(P([CH-]P(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H21P2.ClH.Pd/c1-5-13-22(14-6-1)26(23-15-7-2-8-16-23)21-27(24-17-9-3-10-18-24)25-19-11-4-12-20-25;;/h1-21H;1H;/q-1;;+2/p-1 |
| InChIKey | OWHFHCDNXQZLGG-UHFFFAOYSA-M |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 525.26 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloropalladium(1+);diphenylphosphanylmethyl(diphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloropalladium(1+);diphenylphosphanylmethyl(diphenyl)phosphane?
The IUPAC name of chloropalladium(1+);diphenylphosphanylmethyl(diphenyl)phosphane (CID 87662459) is chloropalladium(1+);diphenylphosphanylmethyl(diphenyl)phosphane.
What is the SMILES notation for chloropalladium(1+);diphenylphosphanylmethyl(diphenyl)phosphane?
The canonical SMILES for chloropalladium(1+);diphenylphosphanylmethyl(diphenyl)phosphane is Cl[Pd+].c1ccc(P([CH-]P(c2ccccc2)c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of chloropalladium(1+);diphenylphosphanylmethyl(diphenyl)phosphane?
The InChIKey is OWHFHCDNXQZLGG-UHFFFAOYSA-M. The full InChI is InChI=1S/C25H21P2.ClH.Pd/c1-5-13-22(14-6-1)26(23-15-7-2-8-16-23)21-27(24-17-9-3-10-18-24)25-19-11-4-12-20-25;;/h1-21H;1H;/q-1;;+2/p-1.
What are the key properties of chloropalladium(1+);diphenylphosphanylmethyl(diphenyl)phosphane?
chloropalladium(1+);diphenylphosphanylmethyl(diphenyl)phosphane has a molecular weight of 525.26 g/mol, XLogP of 6.06, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloropalladium(1+);diphenylphosphanylmethyl(diphenyl)phosphane is sourced from PubChem (CID 87662459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).