C13H17N5O8S2 — CID 87674370
2-[[2-(2-amino-2-methyl-4-oxo-1-sulfoazetidin-3-yl)-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxy-2-methylpropanoic acid (PubChem CID 87674370) has the molecular formula C13H17N5O8S2 and a molecular weight of 435.44 g/mol. Its IUPAC name is 2-[[2-(2-amino-2-methyl-4-oxo-1-sulfoazetidin-3-yl)-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxy-2-methylpropanoic acid.
| Compound Name | 2-[[2-(2-amino-2-methyl-4-oxo-1-sulfoazetidin-3-yl)-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 87674370 |
| Molecular Formula | C13H17N5O8S2 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | 2-[[2-(2-amino-2-methyl-4-oxo-1-sulfoazetidin-3-yl)-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
| SMILES | CC(C)(ON=C(C(=O)C1C(=O)N(S(=O)(=O)O)C1(C)N)c1csc(N)n1)C(=O)O |
| InChI | InChI=1S/C13H17N5O8S2/c1-12(2,10(21)22)26-17-7(5-4-27-11(14)16-5)8(19)6-9(20)18(13(6,3)15)28(23,24)25/h4,6H,15H2,1-3H3,(H2,14,16)(H,21,22)(H,23,24,25) |
| InChIKey | OBHMBGLQHFCMAK-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 215.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|