C24H16F6N2O5S2 — CID 87678673
7-hydroxy-2,4-bis[2-(trifluoromethyl)phenyl]naphthalene-1,3-disulfonamide (PubChem CID 87678673) has the molecular formula C24H16F6N2O5S2 and a molecular weight of 590.52 g/mol. Its IUPAC name is 7-hydroxy-2,4-bis[2-(trifluoromethyl)phenyl]naphthalene-1,3-disulfonamide.
| Compound Name | 7-hydroxy-2,4-bis[2-(trifluoromethyl)phenyl]naphthalene-1,3-disulfonamide |
|---|---|
| PubChem CID | 87678673 |
| Molecular Formula | C24H16F6N2O5S2 |
| Molecular Weight | 590.52 g/mol |
| Exact Mass | 590.04 |
| IUPAC Name | 7-hydroxy-2,4-bis[2-(trifluoromethyl)phenyl]naphthalene-1,3-disulfonamide |
| SMILES | NS(=O)(=O)c1c(-c2ccccc2C(F)(F)F)c(S(N)(=O)=O)c2cc(O)ccc2c1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C24H16F6N2O5S2/c25-23(26,27)17-7-3-1-5-14(17)19-13-10-9-12(33)11-16(13)21(38(31,34)35)20(22(19)39(32,36)37)15-6-2-4-8-18(15)24(28,29)30/h1-11,33H,(H2,31,34,35)(H2,32,36,37) |
| InChIKey | WMPFAQSPGVSVHT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |