C11H22N3O4+ — CID 8768038
[2-(tert-butylamino)-2-oxoethyl]-[2-(methoxycarbonylamino)-2-oxoethyl]-methylazanium (PubChem CID 8768038) has the molecular formula C11H22N3O4+ and a molecular weight of 260.31 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl]-[2-(methoxycarbonylamino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl]-[2-(methoxycarbonylamino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8768038 |
| Molecular Formula | C11H22N3O4+ |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl]-[2-(methoxycarbonylamino)-2-oxoethyl]-methylazanium |
| SMILES | COC(=O)NC(=O)C[NH+](C)CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H21N3O4/c1-11(2,3)13-9(16)7-14(4)6-8(15)12-10(17)18-5/h6-7H2,1-5H3,(H,13,16)(H,12,15,17)/p+1 |
| InChIKey | DARQITSZJRRPRJ-UHFFFAOYSA-O |
| XLogP | -1.70 |
| TPSA | 88.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |