C35H44NO5S2+ — CID 87681189
4-methylbenzenesulfonic acid;trimethyl-[2-[2-(2-tritylsulfanylethoxy)ethoxy]ethyl]azanium (PubChem CID 87681189) has the molecular formula C35H44NO5S2+ and a molecular weight of 622.87 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;trimethyl-[2-[2-(2-tritylsulfanylethoxy)ethoxy]ethyl]azanium.
| Compound Name | 4-methylbenzenesulfonic acid;trimethyl-[2-[2-(2-tritylsulfanylethoxy)ethoxy]ethyl]azanium |
|---|---|
| PubChem CID | 87681189 |
| Molecular Formula | C35H44NO5S2+ |
| Molecular Weight | 622.87 g/mol |
| Exact Mass | 622.27 |
| IUPAC Name | 4-methylbenzenesulfonic acid;trimethyl-[2-[2-(2-tritylsulfanylethoxy)ethoxy]ethyl]azanium |
| SMILES | C[N+](C)(C)CCOCCOCCSC(c1ccccc1)(c1ccccc1)c1ccccc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C28H36NO2S.C7H8O3S/c1-29(2,3)19-20-30-21-22-31-23-24-32-28(25-13-7-4-8-14-25,26-15-9-5-10-16-26)27-17-11-6-12-18-27;1-6-2-4-7(5-3-6)11(8,9)10/h4-18H,19-24H2,1-3H3;2-5H,1H3,(H,8,9,10)/q+1; |
| InChIKey | MQQDRAPMEXUOID-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.87 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|