C16H30NO5S2+ — CID 87680785
4-methylbenzenesulfonic acid;trimethyl-[2-[2-(2-sulfanylethoxy)ethoxy]ethyl]azanium (PubChem CID 87680785) has the molecular formula C16H30NO5S2+ and a molecular weight of 380.55 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;trimethyl-[2-[2-(2-sulfanylethoxy)ethoxy]ethyl]azanium.
| Compound Name | 4-methylbenzenesulfonic acid;trimethyl-[2-[2-(2-sulfanylethoxy)ethoxy]ethyl]azanium |
|---|---|
| PubChem CID | 87680785 |
| Molecular Formula | C16H30NO5S2+ |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 4-methylbenzenesulfonic acid;trimethyl-[2-[2-(2-sulfanylethoxy)ethoxy]ethyl]azanium |
| SMILES | C[N+](C)(C)CCOCCOCCS.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C9H21NO2S.C7H8O3S/c1-10(2,3)4-5-11-6-7-12-8-9-13;1-6-2-4-7(5-3-6)11(8,9)10/h4-9H2,1-3H3;2-5H,1H3,(H,8,9,10)/p+1 |
| InChIKey | XJVPOJXNRFLCQM-UHFFFAOYSA-O |
| XLogP | 1.90 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|