C19H30S3 — CID 87689699
(8R,9R,10R,13S,14S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7,17-trithiol (PubChem CID 87689699) has the molecular formula C19H30S3 and a molecular weight of 354.65 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7,17-trithiol.
| Compound Name | (8R,9R,10R,13S,14S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7,17-trithiol |
|---|---|
| PubChem CID | 87689699 |
| Molecular Formula | C19H30S3 |
| Molecular Weight | 354.65 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (8R,9R,10R,13S,14S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7,17-trithiol |
| SMILES | C[C@]12CCC(S)CC1=CC(S)[C@@H]1[C@H]2CC[C@]2(C)C(S)CC[C@@H]12 |
| InChI | InChI=1S/C19H30S3/c1-18-7-5-12(20)9-11(18)10-15(21)17-13-3-4-16(22)19(13,2)8-6-14(17)18/h10,12-17,20-22H,3-9H2,1-2H3/t12?,13-,14+,15?,16?,17-,18-,19-/m0/s1 |
| InChIKey | LNJPRFSFMHBZOE-HVVBNRJFSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.65 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|