C20H23N3O3 — CID 87690652
2-N-benzyl-3-cyclopentyl-2-N-methoxypyridine-2,4-dicarboxamide (PubChem CID 87690652) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 2-N-benzyl-3-cyclopentyl-2-N-methoxypyridine-2,4-dicarboxamide.
| Compound Name | 2-N-benzyl-3-cyclopentyl-2-N-methoxypyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 87690652 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 2-N-benzyl-3-cyclopentyl-2-N-methoxypyridine-2,4-dicarboxamide |
| SMILES | CON(Cc1ccccc1)C(=O)c1nccc(C(N)=O)c1C1CCCC1 |
| InChI | InChI=1S/C20H23N3O3/c1-26-23(13-14-7-3-2-4-8-14)20(25)18-17(15-9-5-6-10-15)16(19(21)24)11-12-22-18/h2-4,7-8,11-12,15H,5-6,9-10,13H2,1H3,(H2,21,24) |
| InChIKey | PZPIRLVNDFMMNI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|