C21H20O2S2 — CID 87693158
7-methoxy-7-methyl-3-methylsulfanyl-2-(sulfanylmethyl)benzo[c]fluoren-5-ol (PubChem CID 87693158) has the molecular formula C21H20O2S2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 7-methoxy-7-methyl-3-methylsulfanyl-2-(sulfanylmethyl)benzo[c]fluoren-5-ol.
| Compound Name | 7-methoxy-7-methyl-3-methylsulfanyl-2-(sulfanylmethyl)benzo[c]fluoren-5-ol |
|---|---|
| PubChem CID | 87693158 |
| Molecular Formula | C21H20O2S2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 7-methoxy-7-methyl-3-methylsulfanyl-2-(sulfanylmethyl)benzo[c]fluoren-5-ol |
| SMILES | COC1(C)c2ccccc2-c2c1cc(O)c1cc(SC)c(CS)cc21 |
| InChI | InChI=1S/C21H20O2S2/c1-21(23-2)16-7-5-4-6-13(16)20-15-8-12(11-24)19(25-3)9-14(15)18(22)10-17(20)21/h4-10,22,24H,11H2,1-3H3 |
| InChIKey | ILVVEOSAULOVSZ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|