C18H20N2O6S — CID 87693204
(E)-4-[4-[(3,4-dimethoxyphenyl)sulfamoyl]phenyl]-N-hydroxybut-3-enamide (PubChem CID 87693204) has the molecular formula C18H20N2O6S and a molecular weight of 392.43 g/mol. Its IUPAC name is (E)-4-[4-[(3,4-dimethoxyphenyl)sulfamoyl]phenyl]-N-hydroxybut-3-enamide.
| Compound Name | (E)-4-[4-[(3,4-dimethoxyphenyl)sulfamoyl]phenyl]-N-hydroxybut-3-enamide |
|---|---|
| PubChem CID | 87693204 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | (E)-4-[4-[(3,4-dimethoxyphenyl)sulfamoyl]phenyl]-N-hydroxybut-3-enamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(/C=C/CC(=O)NO)cc2)cc1OC |
| InChI | InChI=1S/C18H20N2O6S/c1-25-16-11-8-14(12-17(16)26-2)20-27(23,24)15-9-6-13(7-10-15)4-3-5-18(21)19-22/h3-4,6-12,20,22H,5H2,1-2H3,(H,19,21)/b4-3+ |
| InChIKey | KPDAPNJTHGUXHT-ONEGZZNKSA-N |
| XLogP | 2.41 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|