C31H23BrO2 — CID 87693704
2-bromo-7-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-phenylphenyl]xanthen-9-one (PubChem CID 87693704) has the molecular formula C31H23BrO2 and a molecular weight of 507.43 g/mol. Its IUPAC name is 2-bromo-7-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-phenylphenyl]xanthen-9-one.
| Compound Name | 2-bromo-7-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-phenylphenyl]xanthen-9-one |
|---|---|
| PubChem CID | 87693704 |
| Molecular Formula | C31H23BrO2 |
| Molecular Weight | 507.43 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | 2-bromo-7-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-phenylphenyl]xanthen-9-one |
| SMILES | C/C=C\C(=C/C)c1cc(-c2ccccc2)cc(-c2ccc3oc4ccc(Br)cc4c(=O)c3c2)c1 |
| InChI | InChI=1S/C31H23BrO2/c1-3-8-20(4-2)23-15-24(21-9-6-5-7-10-21)17-25(16-23)22-11-13-29-27(18-22)31(33)28-19-26(32)12-14-30(28)34-29/h3-19H,1-2H3/b8-3-,20-4+ |
| InChIKey | YVIMDVUIWZEGKF-HWVWIRTMSA-N |
| XLogP | 9.02 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.43 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|