C21H22ClN5OS2 — CID 87694942
1-[1-(7-chloroquinazolin-4-yl)piperidin-4-yl]-3-(2-methylsulfanylphenyl)-1-sulfanylurea (PubChem CID 87694942) has the molecular formula C21H22ClN5OS2 and a molecular weight of 460.03 g/mol. Its IUPAC name is 1-[1-(7-chloroquinazolin-4-yl)piperidin-4-yl]-3-(2-methylsulfanylphenyl)-1-sulfanylurea.
| Compound Name | 1-[1-(7-chloroquinazolin-4-yl)piperidin-4-yl]-3-(2-methylsulfanylphenyl)-1-sulfanylurea |
|---|---|
| PubChem CID | 87694942 |
| Molecular Formula | C21H22ClN5OS2 |
| Molecular Weight | 460.03 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 1-[1-(7-chloroquinazolin-4-yl)piperidin-4-yl]-3-(2-methylsulfanylphenyl)-1-sulfanylurea |
| SMILES | CSc1ccccc1NC(=O)N(S)C1CCN(c2ncnc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C21H22ClN5OS2/c1-30-19-5-3-2-4-17(19)25-21(28)27(29)15-8-10-26(11-9-15)20-16-7-6-14(22)12-18(16)23-13-24-20/h2-7,12-13,15,29H,8-11H2,1H3,(H,25,28) |
| InChIKey | JZSFINBXRQGPQN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.03 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|