C19H24O — CID 87696703
(8S,9R,10S,13R)-13-methyl-2,3,4,5,9,10,11,12-octahydro-1H-cyclopenta[a]phenanthrene-8-carbaldehyde (PubChem CID 87696703) has the molecular formula C19H24O and a molecular weight of 268.40 g/mol. Its IUPAC name is (8S,9R,10S,13R)-13-methyl-2,3,4,5,9,10,11,12-octahydro-1H-cyclopenta[a]phenanthrene-8-carbaldehyde.
| Compound Name | (8S,9R,10S,13R)-13-methyl-2,3,4,5,9,10,11,12-octahydro-1H-cyclopenta[a]phenanthrene-8-carbaldehyde |
|---|---|
| PubChem CID | 87696703 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | (8S,9R,10S,13R)-13-methyl-2,3,4,5,9,10,11,12-octahydro-1H-cyclopenta[a]phenanthrene-8-carbaldehyde |
| SMILES | C[C@@]12C=CC=C1[C@]1(C=O)C=CC3CCCC[C@@H]3[C@H]1CC2 |
| InChI | InChI=1S/C19H24O/c1-18-10-4-7-17(18)19(13-20)12-8-14-5-2-3-6-15(14)16(19)9-11-18/h4,7-8,10,12-16H,2-3,5-6,9,11H2,1H3/t14?,15-,16+,18-,19-/m0/s1 |
| InChIKey | DROVLBOBBWKRPU-LGOHOSHXSA-N |
| XLogP | 4.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|