C29H38AsO8 — CID 87701065
CID 87701065 (PubChem CID 87701065) has the molecular formula C29H38AsO8 and a molecular weight of 589.54 g/mol.
| Compound Name | CID 87701065 |
|---|---|
| PubChem CID | 87701065 |
| Molecular Formula | C29H38AsO8 |
| Molecular Weight | 589.54 g/mol |
| Exact Mass | 589.18 |
| IUPAC Name | — |
| SMILES | CCCC(COCCOCCOCCOCCC(=O)O)[As]C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H38AsO8/c1-2-7-22(20-37-19-18-36-17-16-35-15-14-34-13-12-28(31)32)30-29(33)38-21-27-25-10-5-3-8-23(25)24-9-4-6-11-26(24)27/h3-6,8-11,22,27H,2,7,12-21H2,1H3,(H,31,32) |
| InChIKey | ONDPXEJMOQTPMG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|